CAS 204633-92-1 appears in our catalog under these names: L–Arginine–15N2 hydrochloride, L-ARGININE-(GUANIDINEIMINO-15N2) HYDROC&, L-Arginine-15N2 (hydrochloride), 98.0%, 98.0%, L-Arginine-15N2 (hydrochloride), 99.97%. Offered by: GLPBio, Sigma-Aldrich, Chemat, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 1G, 5mg, 25 mg, 5 mg, 50 mg.
(2S)-2-amino-5-[bis(15N)(azanyl)methylideneamino]pentanoic acid;hydrochloride (CAS 204633-92-1) is a chemical compound with the molecular formula C6H15ClN4O2 and a molecular weight of 212.65 g/mol. IUPAC name: (2S)-2-amino-5-[bis(15N)(azanyl)methylideneamino]pentanoic acid;hydrochloride. InChIKey: KWTQSFXGGICVPE-SXTJCFDNSA-N.
| Molecular formula | C6H15ClN4O2 |
|---|---|
| Molecular weight | 212.65 g/mol |
| IUPAC name | (2S)-2-amino-5-[bis(15N)(azanyl)methylideneamino]pentanoic acid;hydrochloride |
| InChIKey | KWTQSFXGGICVPE-SXTJCFDNSA-N |
| SMILES | C(C[C@@H](C(=O)O)N)CN=C([15NH2])[15NH2].Cl |
Computed by PubChem (NCBI)