CAS 2058-72-2 appears in our catalog under these names: 5-Bromo-1-methylisatin, >98.0%(GC), 5-Bromo-1-methylindoline-2,3-dione 95%, 5-Bromo-1-methylindoline-2,3-dione, 95%, 95%, 5-bromo-1-methyl-1H-indole-2,3-dione, 95%. Offered by: TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100g, 250mg, 25g, 10g.
5-bromo-1-methylindole-2,3-dione (CAS 2058-72-2) is a chemical compound with the molecular formula C9H6BrNO2 and a molecular weight of 240.05 g/mol. IUPAC name: 5-bromo-1-methylindole-2,3-dione. InChIKey: GEEDYJPPYNIZLX-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO2 |
|---|---|
| Molecular weight | 240.05 g/mol |
| IUPAC name | 5-bromo-1-methylindole-2,3-dione |
| InChIKey | GEEDYJPPYNIZLX-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=C2)Br)C(=O)C1=O |
Computed by PubChem (NCBI)