CAS 205877-26-5 appears in our catalog under these names: 4–Ethynyltriphenylamine, 4-Ethynyltriphenylamine, >98.0%(HPLC)(N), 4-Ethynyl-N,N-diphenylaniline 97%, 4-Ethynyl-N,N-diphenylbenzenamine, 97%, 97%, 4-ETHYNYL-N,N-DIPHENYLANILINE, 95%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 25g, 10g.
4-ethynyl-N,N-diphenylaniline (CAS 205877-26-5) is a chemical compound with the molecular formula C20H15N and a molecular weight of 269.3 g/mol. IUPAC name: 4-ethynyl-N,N-diphenylaniline. InChIKey: QDYFCLVSLUZDHB-UHFFFAOYSA-N.
| Molecular formula | C20H15N |
|---|---|
| Molecular weight | 269.3 g/mol |
| IUPAC name | 4-ethynyl-N,N-diphenylaniline |
| InChIKey | QDYFCLVSLUZDHB-UHFFFAOYSA-N |
| SMILES | C#CC1=CC=C(C=C1)N(C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)