CAS 2059976-14-4 appears in our catalog under these names: 4-(4-(Chloromethyl)-1,3-oxazol-2-yl)pyridine hydrochloride, 4-(4-(Chloromethyl)-1,3-oxazol-2-yl)pyridine hydrochloride, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g.
4-(chloromethyl)-2-pyridin-4-yl-1,3-oxazole;hydrochloride (CAS 2059976-14-4) is a chemical compound with the molecular formula C9H8Cl2N2O and a molecular weight of 231.08 g/mol. IUPAC name: 4-(chloromethyl)-2-pyridin-4-yl-1,3-oxazole;hydrochloride. InChIKey: ZPCHTJQYGGIULU-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl2N2O |
|---|---|
| Molecular weight | 231.08 g/mol |
| IUPAC name | 4-(chloromethyl)-2-pyridin-4-yl-1,3-oxazole;hydrochloride |
| InChIKey | ZPCHTJQYGGIULU-UHFFFAOYSA-N |
| SMILES | C1=CN=CC=C1C2=NC(=CO2)CCl.Cl |
Computed by PubChem (NCBI)