Products 2060047-64-3
CAS 2060047-64-3 is the registry number for 5-methylimidazo[1,2-a]pyridine-8-carboxylic acid, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
5-methylimidazo[1,2-a]pyridine-8-carboxylic acid (CAS 2060047-64-3) is a chemical compound with the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. IUPAC name: 5-methylimidazo[1,2-a]pyridine-8-carboxylic acid. InChIKey: VJMOYIOBBLIPHF-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O2 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | 5-methylimidazo[1,2-a]pyridine-8-carboxylic acid |
| InChIKey | VJMOYIOBBLIPHF-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C2=NC=CN12)C(=O)O |
Computed by PubChem (NCBI)