CAS 20737-88-6 appears in our catalog under these names: 3-Methyl-1-phenyl-1h-pyrazol-5-amine hydrochloride, 98%, 98%, 3-Methyl-1-phenyl-1h-pyrazol-5-amine hydrochloride, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g, 100g.
5-methyl-2-phenylpyrazol-3-amine;hydrochloride (CAS 20737-88-6) is a chemical compound with the molecular formula C10H12ClN3 and a molecular weight of 209.67 g/mol. IUPAC name: 5-methyl-2-phenylpyrazol-3-amine;hydrochloride. InChIKey: ZPBIGHWKZQVKTE-UHFFFAOYSA-N.
| Molecular formula | C10H12ClN3 |
|---|---|
| Molecular weight | 209.67 g/mol |
| IUPAC name | 5-methyl-2-phenylpyrazol-3-amine;hydrochloride |
| InChIKey | ZPBIGHWKZQVKTE-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=C1)N)C2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)