CAS 20754-20-5 appears in our catalog under these names: Ozagrel Impurity 13, Ozagrel Impurity 2, Methyl (E)-3-(p-tolyl)acrylate, 95%, Methyl (2E)–3–(4–methylphenyl)propenoate, Methyl (E)-3-(p-Tolyl)acrylate, >98.0%(GC). Offered by: Chemat Brand, AmBeed, GLPBio, TCI, Chemat. Available pack sizes: on request, 5g, 25g, 100g.
Methyl (E)-3-(4-methylphenyl)prop-2-enoate (CAS 20754-20-5) is a chemical compound with the molecular formula C11H12O2 and a molecular weight of 176.21 g/mol. IUPAC name: methyl (E)-3-(4-methylphenyl)prop-2-enoate. InChIKey: WLJBRXRCJNSDHT-BQYQJAHWSA-N.
| Molecular formula | C11H12O2 |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | methyl (E)-3-(4-methylphenyl)prop-2-enoate |
| InChIKey | WLJBRXRCJNSDHT-BQYQJAHWSA-N |
| SMILES | CC1=CC=C(C=C1)/C=C/C(=O)OC |
Computed by PubChem (NCBI)