Products 50363-84-3
CAS 50363-84-3 is the registry number for Methyl (Z)-3-(p-tolyl)acrylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (Z)-3-(4-methylphenyl)prop-2-enoate (CAS 50363-84-3) is a chemical compound with the molecular formula C11H12O2 and a molecular weight of 176.21 g/mol. IUPAC name: methyl (Z)-3-(4-methylphenyl)prop-2-enoate. InChIKey: WLJBRXRCJNSDHT-FPLPWBNLSA-N.
| Molecular formula | C11H12O2 |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | methyl (Z)-3-(4-methylphenyl)prop-2-enoate |
| InChIKey | WLJBRXRCJNSDHT-FPLPWBNLSA-N |
| SMILES | CC1=CC=C(C=C1)/C=C\C(=O)OC |
Computed by PubChem (NCBI)