CAS 207683-94-1 appears in our catalog under these names: N–(1–Oxo–1,3–dihydroisobenzofuran–5–yl)acetamide, 5-Acetamido-phthalide, 95%. Offered by: GLPBio, Combi-blocks. Available pack sizes: 100mg, 1g, 250mg.
N-(1-oxo-3H-2-benzofuran-5-yl)acetamide (CAS 207683-94-1) is a chemical compound with the molecular formula C10H9NO3 and a molecular weight of 191.18 g/mol. IUPAC name: N-(1-oxo-3H-2-benzofuran-5-yl)acetamide. InChIKey: XBLPTNDIRVYALA-UHFFFAOYSA-N.
| Molecular formula | C10H9NO3 |
|---|---|
| Molecular weight | 191.18 g/mol |
| IUPAC name | N-(1-oxo-3H-2-benzofuran-5-yl)acetamide |
| InChIKey | XBLPTNDIRVYALA-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC2=C(C=C1)C(=O)OC2 |
Computed by PubChem (NCBI)