CAS 207804-97-5 is the registry number for 6-Nitroisochroman, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 5g.
6-nitro-3,4-dihydro-1H-isochromene (CAS 207804-97-5) is a chemical compound with the molecular formula C9H9NO3 and a molecular weight of 179.17 g/mol. IUPAC name: 6-nitro-3,4-dihydro-1H-isochromene. InChIKey: RTBMEWOVRPAVMS-UHFFFAOYSA-N.
| Molecular formula | C9H9NO3 |
|---|---|
| Molecular weight | 179.17 g/mol |
| IUPAC name | 6-nitro-3,4-dihydro-1H-isochromene |
| InChIKey | RTBMEWOVRPAVMS-UHFFFAOYSA-N |
| SMILES | C1COCC2=C1C=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)