CAS 207974-19-4 appears in our catalog under these names: 2,3-Difluoromandelic acid, 95%, 2,3–Difluoromandelic acid, 2-(2,3-Difluorophenyl)-2-hydroxyacetic acid, ≥97%, ≥97%, 2,3-Difluoromandelic acid, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g.
2-(2,3-difluorophenyl)-2-hydroxyacetic acid (CAS 207974-19-4) is a chemical compound with the molecular formula C8H6F2O3 and a molecular weight of 188.13 g/mol. IUPAC name: 2-(2,3-difluorophenyl)-2-hydroxyacetic acid. InChIKey: LBJOAPZLJUKPRG-UHFFFAOYSA-N.
| Molecular formula | C8H6F2O3 |
|---|---|
| Molecular weight | 188.13 g/mol |
| IUPAC name | 2-(2,3-difluorophenyl)-2-hydroxyacetic acid |
| InChIKey | LBJOAPZLJUKPRG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)F)C(C(=O)O)O |
Computed by PubChem (NCBI)