CAS 208117-17-3 is the registry number for 4-Benzothiazoleacetic Acid. Offered by: TRC. Available pack sizes: 5g.
2-(1,3-benzothiazol-4-yl)acetic acid (CAS 208117-17-3) is a chemical compound with the molecular formula C9H7NO2S and a molecular weight of 193.22 g/mol. IUPAC name: 2-(1,3-benzothiazol-4-yl)acetic acid. InChIKey: YAQGYEOIXUKLKH-UHFFFAOYSA-N.
| Molecular formula | C9H7NO2S |
|---|---|
| Molecular weight | 193.22 g/mol |
| IUPAC name | 2-(1,3-benzothiazol-4-yl)acetic acid |
| InChIKey | YAQGYEOIXUKLKH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1)SC=N2)CC(=O)O |
Computed by PubChem (NCBI)