CAS 208459-17-0 appears in our catalog under these names: Glycine 7–amido–4–methylcoumarin hydrochloride, Glycine 7-amido-4-methylcoumarin hydrochloride, 95%, 95%, 2-Amino-N-(4-methyl-2-oxo-2H-chromen-7-yl)acetamide hydrochloride, 95%, Gly-AMC HCl, 95%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1mg, 50mg, 100mg, 250mg.
2-amino-N-(4-methyl-2-oxochromen-7-yl)acetamide;hydrochloride (CAS 208459-17-0) is a chemical compound with the molecular formula C12H13ClN2O3 and a molecular weight of 268.69 g/mol. IUPAC name: 2-amino-N-(4-methyl-2-oxochromen-7-yl)acetamide;hydrochloride. InChIKey: DGTMMNCLSKYGIF-UHFFFAOYSA-N.
| Molecular formula | C12H13ClN2O3 |
|---|---|
| Molecular weight | 268.69 g/mol |
| IUPAC name | 2-amino-N-(4-methyl-2-oxochromen-7-yl)acetamide;hydrochloride |
| InChIKey | DGTMMNCLSKYGIF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)OC2=C1C=CC(=C2)NC(=O)CN.Cl |
Computed by PubChem (NCBI)