CAS 20877-81-0 appears in our catalog under these names: 5–Methyl–2H–benzo(d)(1,3)oxazine–2,4(1H)–dione, 5-methyl-2H-benzo(d)(1,3)oxazine-2,4(1H)-dione, 5-Methyl-2H-benzo[d][1,3]oxazine-2,4(1H)-dione, 97%, 97%, 5-Methyl-2H-benzo[d][1,3]oxazine-2,4(1H)-dione, 97%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 5g, 2,5g, 100mg, 10g, 25g.
5-methyl-1H-3,1-benzoxazine-2,4-dione (CAS 20877-81-0) is a chemical compound with the molecular formula C9H7NO3 and a molecular weight of 177.16 g/mol. IUPAC name: 5-methyl-1H-3,1-benzoxazine-2,4-dione. InChIKey: KJBDXWPWJNDBOS-UHFFFAOYSA-N.
| Molecular formula | C9H7NO3 |
|---|---|
| Molecular weight | 177.16 g/mol |
| IUPAC name | 5-methyl-1H-3,1-benzoxazine-2,4-dione |
| InChIKey | KJBDXWPWJNDBOS-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)NC(=O)OC2=O |
Computed by PubChem (NCBI)