Products 2088545-68-8
CAS 2088545-68-8 is the registry number for MPO-IN-4. Offered by: MedChemExpress. Available pack sizes: Get quote.
7-benzyl-2H-triazolo[4,5-b]pyridin-5-amine (CAS 2088545-68-8) is a chemical compound with the molecular formula C12H11N5 and a molecular weight of 225.25 g/mol. IUPAC name: 7-benzyl-2H-triazolo[4,5-b]pyridin-5-amine. InChIKey: SGFFXIGIHATQNC-UHFFFAOYSA-N.
| Molecular formula | C12H11N5 |
|---|---|
| Molecular weight | 225.25 g/mol |
| IUPAC name | 7-benzyl-2H-triazolo[4,5-b]pyridin-5-amine |
| InChIKey | SGFFXIGIHATQNC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=CC(=NC3=NNN=C23)N |
Computed by PubChem (NCBI)