CAS 2089-80-7 is the registry number for 2,3-Dihydroxy-1-naphthaldehyde. Offered by: TRC. Available pack sizes: 1g.
2,3-dihydroxynaphthalene-1-carbaldehyde (CAS 2089-80-7) is a chemical compound with the molecular formula C11H8O3 and a molecular weight of 188.18 g/mol. IUPAC name: 2,3-dihydroxynaphthalene-1-carbaldehyde. InChIKey: HONJWUZXQQEEHP-UHFFFAOYSA-N.
| Molecular formula | C11H8O3 |
|---|---|
| Molecular weight | 188.18 g/mol |
| IUPAC name | 2,3-dihydroxynaphthalene-1-carbaldehyde |
| InChIKey | HONJWUZXQQEEHP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(C(=C2C=O)O)O |
Computed by PubChem (NCBI)