CAS 2089245-14-5 is the registry number for tert-Butyl (3R)-piperidine-3-carboxylate hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
Tert-butyl (3R)-piperidine-3-carboxylate;hydrochloride (CAS 2089245-14-5) is a chemical compound with the molecular formula C10H20ClNO2 and a molecular weight of 221.72 g/mol. IUPAC name: tert-butyl (3R)-piperidine-3-carboxylate;hydrochloride. InChIKey: FNTUZXRGYYMCBP-DDWIOCJRSA-N.
| Molecular formula | C10H20ClNO2 |
|---|---|
| Molecular weight | 221.72 g/mol |
| IUPAC name | tert-butyl (3R)-piperidine-3-carboxylate;hydrochloride |
| InChIKey | FNTUZXRGYYMCBP-DDWIOCJRSA-N |
| SMILES | CC(C)(C)OC(=O)[C@@H]1CCCNC1.Cl |
Computed by PubChem (NCBI)