Products 2089257-11-2
CAS 2089257-11-2 is the registry number for 2-{((tert-Butoxy)carbonyl)amino}-2-(3-nitrophenyl)propanoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(3-nitrophenyl)propanoic acid (CAS 2089257-11-2) is a chemical compound with the molecular formula C14H18N2O6 and a molecular weight of 310.30 g/mol. IUPAC name: 2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(3-nitrophenyl)propanoic acid. InChIKey: WFKULWMLCIGTKJ-UHFFFAOYSA-N.
| Molecular formula | C14H18N2O6 |
|---|---|
| Molecular weight | 310.30 g/mol |
| IUPAC name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(3-nitrophenyl)propanoic acid |
| InChIKey | WFKULWMLCIGTKJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(C)(C1=CC(=CC=C1)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)