Products 2089257-50-9
CAS 2089257-50-9 is the registry number for 5-(2,3-Dihydro-1,4-benzodioxin-6-yl)-2-methylaniline hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylaniline;hydrochloride (CAS 2089257-50-9) is a chemical compound with the molecular formula C15H16ClNO2 and a molecular weight of 277.74 g/mol. IUPAC name: 5-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylaniline;hydrochloride. InChIKey: XOHQHVPPCMQENK-UHFFFAOYSA-N.
| Molecular formula | C15H16ClNO2 |
|---|---|
| Molecular weight | 277.74 g/mol |
| IUPAC name | 5-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylaniline;hydrochloride |
| InChIKey | XOHQHVPPCMQENK-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C2=CC3=C(C=C2)OCCO3)N.Cl |
Computed by PubChem (NCBI)