Products 2089291-82-5
CAS 2089291-82-5 is the registry number for 2-Amino-3-methyl-3-phenylbutanoic acid hydrochloride, 98%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-amino-3-methyl-3-phenylbutanoic acid;hydrochloride (CAS 2089291-82-5) is a chemical compound with the molecular formula C11H16ClNO2 and a molecular weight of 229.70 g/mol. IUPAC name: 2-amino-3-methyl-3-phenylbutanoic acid;hydrochloride. InChIKey: PYZJKCJWFIRCOO-UHFFFAOYSA-N.
| Molecular formula | C11H16ClNO2 |
|---|---|
| Molecular weight | 229.70 g/mol |
| IUPAC name | 2-amino-3-methyl-3-phenylbutanoic acid;hydrochloride |
| InChIKey | PYZJKCJWFIRCOO-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC=CC=C1)C(C(=O)O)N.Cl |
Computed by PubChem (NCBI)