CAS 2089325-37-9 appears in our catalog under these names: 6–Fluoro–2–methylpyrido(3,4–d)pyrimidin–4(3H)–one, 6-Fluoro-2-methylpyrido[3,4-d]pyrimidin-4(3H)-one, 97%, 97%, 6-fluoro-2-methyl-1H,4H-pyrido[3,4-d]pyrimidin-4-one, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 25mg, 100mg, 250mg, 1g.
6-fluoro-2-methyl-3H-pyrido[3,4-d]pyrimidin-4-one (CAS 2089325-37-9) is a chemical compound with the molecular formula C8H6FN3O and a molecular weight of 179.15 g/mol. IUPAC name: 6-fluoro-2-methyl-3H-pyrido[3,4-d]pyrimidin-4-one. InChIKey: NRZQYBNESQFOGI-UHFFFAOYSA-N.
| Molecular formula | C8H6FN3O |
|---|---|
| Molecular weight | 179.15 g/mol |
| IUPAC name | 6-fluoro-2-methyl-3H-pyrido[3,4-d]pyrimidin-4-one |
| InChIKey | NRZQYBNESQFOGI-UHFFFAOYSA-N |
| SMILES | CC1=NC2=CN=C(C=C2C(=O)N1)F |
Computed by PubChem (NCBI)