CAS 2090572-71-5 appears in our catalog under these names: 4,5-Dichloro-1H-indole-3-carboxylic acid, 95%, 4,5-Dichloroindole-3-carboxylic acid, 4,5-Dichloroindole-3-carboxylicAcid, >95%, >95%. Offered by: AmBeed, Biosynth, Chemat. Available pack sizes: 1g, 0,5g, 50mg, 100mg, 250mg.
4,5-dichloro-1H-indole-3-carboxylic acid (CAS 2090572-71-5) is a chemical compound with the molecular formula C9H5Cl2NO2 and a molecular weight of 230.04 g/mol. IUPAC name: 4,5-dichloro-1H-indole-3-carboxylic acid. InChIKey: SYSUREQZEXRCGP-UHFFFAOYSA-N.
| Molecular formula | C9H5Cl2NO2 |
|---|---|
| Molecular weight | 230.04 g/mol |
| IUPAC name | 4,5-dichloro-1H-indole-3-carboxylic acid |
| InChIKey | SYSUREQZEXRCGP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1NC=C2C(=O)O)Cl)Cl |
Computed by PubChem (NCBI)