Products 2091217-61-5
CAS 2091217-61-5 is the registry number for Ethyl 3-amino-7-bromofuro[3,2-c]pyridine-2-carboxylate, 97%. Offered by: Ambeed, BLDpharm. Available pack sizes: 250mg, 1g, 50mg, 100mg.
Ethyl 3-amino-7-bromofuro[3,2-c]pyridine-2-carboxylate (CAS 2091217-61-5) is a chemical compound with the molecular formula C10H9BrN2O3 and a molecular weight of 285.09 g/mol. IUPAC name: ethyl 3-amino-7-bromofuro[3,2-c]pyridine-2-carboxylate. InChIKey: ZQSNTSLUTRXWJF-UHFFFAOYSA-N.
| Molecular formula | C10H9BrN2O3 |
|---|---|
| Molecular weight | 285.09 g/mol |
| IUPAC name | ethyl 3-amino-7-bromofuro[3,2-c]pyridine-2-carboxylate |
| InChIKey | ZQSNTSLUTRXWJF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C2=CN=CC(=C2O1)Br)N |
Computed by PubChem (NCBI)