Products 2091666-21-4
CAS 2091666-21-4 is the registry number for 3-Bromo-1,2-difluoro-4-methyl-5-nitrobenzene, 98%. Offered by: Fluorochem, Ambeed, BLDpharm, Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg.
3-bromo-1,2-difluoro-4-methyl-5-nitrobenzene (CAS 2091666-21-4) is a chemical compound with the molecular formula C7H4BrF2NO2 and a molecular weight of 252.01 g/mol. IUPAC name: 3-bromo-1,2-difluoro-4-methyl-5-nitrobenzene. InChIKey: QXPKBMVCETVDMH-UHFFFAOYSA-N.
| Molecular formula | C7H4BrF2NO2 |
|---|---|
| Molecular weight | 252.01 g/mol |
| IUPAC name | 3-bromo-1,2-difluoro-4-methyl-5-nitrobenzene |
| InChIKey | QXPKBMVCETVDMH-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1[N+](=O)[O-])F)F)Br |
Computed by PubChem (NCBI)