Products 2092735-83-4
CAS 2092735-83-4 is the registry number for Methyl 2,6-difluoro-3-methyl-α-oxobenzeneacetate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Methyl 2-(2,6-difluoro-3-methylphenyl)-2-oxoacetate (CAS 2092735-83-4) is a chemical compound with the molecular formula C10H8F2O3 and a molecular weight of 214.16 g/mol. IUPAC name: methyl 2-(2,6-difluoro-3-methylphenyl)-2-oxoacetate. InChIKey: FTWFQBJPIODVFG-UHFFFAOYSA-N.
| Molecular formula | C10H8F2O3 |
|---|---|
| Molecular weight | 214.16 g/mol |
| IUPAC name | methyl 2-(2,6-difluoro-3-methylphenyl)-2-oxoacetate |
| InChIKey | FTWFQBJPIODVFG-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)F)C(=O)C(=O)OC)F |
Computed by PubChem (NCBI)