Products 2092784-04-6
CAS 2092784-04-6 is the registry number for methyl 6-bromo-3-hydroxy-benzofuran-2-carboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 250mg, 500mg, 1g, 5g, 10g, 25g, 100g.
Methyl 6-bromo-3-hydroxy-1-benzofuran-2-carboxylate (CAS 2092784-04-6) is a chemical compound with the molecular formula C10H7BrO4 and a molecular weight of 271.06 g/mol. IUPAC name: methyl 6-bromo-3-hydroxy-1-benzofuran-2-carboxylate. InChIKey: OZANGSVCJYZMCH-UHFFFAOYSA-N.
| Molecular formula | C10H7BrO4 |
|---|---|
| Molecular weight | 271.06 g/mol |
| IUPAC name | methyl 6-bromo-3-hydroxy-1-benzofuran-2-carboxylate |
| InChIKey | OZANGSVCJYZMCH-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C2=C(O1)C=C(C=C2)Br)O |
Computed by PubChem (NCBI)