Products 2313569-89-8
CAS 2313569-89-8 is the registry number for 6-Bromo-5,7-dihydroxy-2-methyl-4H-chromen-4-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-bromo-5,7-dihydroxy-2-methylchromen-4-one (CAS 2313569-89-8) is a chemical compound with the molecular formula C10H7BrO4 and a molecular weight of 271.06 g/mol. IUPAC name: 6-bromo-5,7-dihydroxy-2-methylchromen-4-one. InChIKey: UNWDOLAYTVMEEK-UHFFFAOYSA-N.
| Molecular formula | C10H7BrO4 |
|---|---|
| Molecular weight | 271.06 g/mol |
| IUPAC name | 6-bromo-5,7-dihydroxy-2-methylchromen-4-one |
| InChIKey | UNWDOLAYTVMEEK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)C2=C(O1)C=C(C(=C2O)Br)O |
Computed by PubChem (NCBI)