CAS 440367-78-2 is the registry number for 6-Bromo-4-oxochroman-2-carboxylic acid, 97%. Offered by: AmBeed. Available pack sizes: 1g.
6-bromo-4-oxo-2,3-dihydrochromene-2-carboxylic acid (CAS 440367-78-2) is a chemical compound with the molecular formula C10H7BrO4 and a molecular weight of 271.06 g/mol. IUPAC name: 6-bromo-4-oxo-2,3-dihydrochromene-2-carboxylic acid. InChIKey: JSQMJWWDPOCMSU-UHFFFAOYSA-N.
| Molecular formula | C10H7BrO4 |
|---|---|
| Molecular weight | 271.06 g/mol |
| IUPAC name | 6-bromo-4-oxo-2,3-dihydrochromene-2-carboxylic acid |
| InChIKey | JSQMJWWDPOCMSU-UHFFFAOYSA-N |
| SMILES | C1C(OC2=C(C1=O)C=C(C=C2)Br)C(=O)O |
Computed by PubChem (NCBI)