Products 2092802-81-6
CAS 2092802-81-6 is the registry number for Methyl 5-Bromothieno[2,3-c]pyridine-2-carboxylate, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
Methyl 5-bromothieno[2,3-c]pyridine-2-carboxylate (CAS 2092802-81-6) is a chemical compound with the molecular formula C9H6BrNO2S and a molecular weight of 272.12 g/mol. IUPAC name: methyl 5-bromothieno[2,3-c]pyridine-2-carboxylate. InChIKey: WCXKMQQJXXIVGO-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO2S |
|---|---|
| Molecular weight | 272.12 g/mol |
| IUPAC name | methyl 5-bromothieno[2,3-c]pyridine-2-carboxylate |
| InChIKey | WCXKMQQJXXIVGO-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=CC(=NC=C2S1)Br |
Computed by PubChem (NCBI)