Products 2092850-58-1
CAS 2092850-58-1 is the registry number for 6-Bromo-2,5-dimethylpyrido[2,3-d]pyrimidin-4(3H)-one, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
6-bromo-2,5-dimethyl-3H-pyrido[2,3-d]pyrimidin-4-one (CAS 2092850-58-1) is a chemical compound with the molecular formula C9H8BrN3O and a molecular weight of 254.08 g/mol. IUPAC name: 6-bromo-2,5-dimethyl-3H-pyrido[2,3-d]pyrimidin-4-one. InChIKey: YJRIIMVHGKISHH-UHFFFAOYSA-N.
| Molecular formula | C9H8BrN3O |
|---|---|
| Molecular weight | 254.08 g/mol |
| IUPAC name | 6-bromo-2,5-dimethyl-3H-pyrido[2,3-d]pyrimidin-4-one |
| InChIKey | YJRIIMVHGKISHH-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=O)NC(=NC2=NC=C1Br)C |
Computed by PubChem (NCBI)