CAS 2098553-16-1 is the registry number for 3-(2,6-difluoropyridin-3-yl)oxetan-3-ol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
3-(2,6-difluoro-3-pyridinyl)oxetan-3-ol (CAS 2098553-16-1) is a chemical compound with the molecular formula C8H7F2NO2 and a molecular weight of 187.14 g/mol. IUPAC name: 3-(2,6-difluoro-3-pyridinyl)oxetan-3-ol. InChIKey: WVCUSPUTLJUAQS-UHFFFAOYSA-N.
| Molecular formula | C8H7F2NO2 |
|---|---|
| Molecular weight | 187.14 g/mol |
| IUPAC name | 3-(2,6-difluoro-3-pyridinyl)oxetan-3-ol |
| InChIKey | WVCUSPUTLJUAQS-UHFFFAOYSA-N |
| SMILES | C1C(CO1)(C2=C(N=C(C=C2)F)F)O |
Computed by PubChem (NCBI)