CAS 210962-57-5 appears in our catalog under these names: 3-(3-Cyanophenoxy)propionic acid, 95%, 3–(3–Cyanophenoxy)propionic Acid. Offered by: Combi-blocks, GLPBio. Available pack sizes: 5g, 1g, 250mg.
3-(3-cyanophenoxy)propanoic acid (CAS 210962-57-5) is a chemical compound with the molecular formula C10H9NO3 and a molecular weight of 191.18 g/mol. IUPAC name: 3-(3-cyanophenoxy)propanoic acid. InChIKey: VEWGPSODOLQZBX-UHFFFAOYSA-N.
| Molecular formula | C10H9NO3 |
|---|---|
| Molecular weight | 191.18 g/mol |
| IUPAC name | 3-(3-cyanophenoxy)propanoic acid |
| InChIKey | VEWGPSODOLQZBX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OCCC(=O)O)C#N |
Computed by PubChem (NCBI)