Products 2121515-10-2
CAS 2121515-10-2 appears in our catalog under these names: 4-Chloro-3-fluoro-2-methoxyphenylboronic acid, 95%, 4-Chloro-3-fluoro-2-methoxyphenylboronic acid, ≥95%, (4-chloro-3-fluoro-2-methoxyphenyl)boronic acid, ≥95%, ≥95%. Offered by: Combi-blocks, Fluorochem, Chemat. Available pack sizes: 100mg, 1g.
(4-chloro-3-fluoro-2-methoxyphenyl)boronic acid (CAS 2121515-10-2) is a chemical compound with the molecular formula C7H7BClFO3 and a molecular weight of 204.39 g/mol. IUPAC name: (4-chloro-3-fluoro-2-methoxyphenyl)boronic acid. InChIKey: NMYIUTXZNVHQQX-UHFFFAOYSA-N.
| Molecular formula | C7H7BClFO3 |
|---|---|
| Molecular weight | 204.39 g/mol |
| IUPAC name | (4-chloro-3-fluoro-2-methoxyphenyl)boronic acid |
| InChIKey | NMYIUTXZNVHQQX-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)Cl)F)OC)(O)O |
Computed by PubChem (NCBI)