CAS 2128-93-0 appears in our catalog under these names: 4-Benzoylbiphenyl, >95% (HPLC), 4-Phenylbenzophenone, 4–Benzoylbiphenyl, 4-Benzoylbiphenyl, 99% , 4-Benzoylbiphenyl. Offered by: TRC, Dr. Ehrenstorfer, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth. Available pack sizes: 25g, 100mg, 500g, 100g, 0,5kg, 1kg, 2kg, 1000g.
Phenyl-(4-phenylphenyl)methanone (CAS 2128-93-0) is a chemical compound with the molecular formula C19H14O and a molecular weight of 258.3 g/mol. IUPAC name: phenyl-(4-phenylphenyl)methanone. InChIKey: LYXOWKPVTCPORE-UHFFFAOYSA-N.
| Molecular formula | C19H14O |
|---|---|
| Molecular weight | 258.3 g/mol |
| IUPAC name | phenyl-(4-phenylphenyl)methanone |
| InChIKey | LYXOWKPVTCPORE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)