CAS 21282-12-2 appears in our catalog under these names: Pyr-Phe-OH, Pyr–Phe–OH. Offered by: Creative Peptides, GLPBio, MedChemExpress. Available pack sizes: on request, 1g, 250mg, Get quote.
(2S)-2-[[(2S)-5-oxopyrrolidine-2-carbonyl]amino]-3-phenylpropanoic acid (CAS 21282-12-2) is a chemical compound with the molecular formula C14H16N2O4 and a molecular weight of 276.29 g/mol. IUPAC name: (2S)-2-[[(2S)-5-oxopyrrolidine-2-carbonyl]amino]-3-phenylpropanoic acid. InChIKey: XCEZCXFVJLMPKG-QWRGUYRKSA-N.
| Molecular formula | C14H16N2O4 |
|---|---|
| Molecular weight | 276.29 g/mol |
| IUPAC name | (2S)-2-[[(2S)-5-oxopyrrolidine-2-carbonyl]amino]-3-phenylpropanoic acid |
| InChIKey | XCEZCXFVJLMPKG-QWRGUYRKSA-N |
| SMILES | C1CC(=O)N[C@@H]1C(=O)N[C@@H](CC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)