Products 2135332-31-7
CAS 2135332-31-7 appears in our catalog under these names: 3-(3,5-difluorophenyl)pyrrolidine hydrochloride, 97%, 97%, 3-(3,5-DIFLUOROPHENYL)PYRROLIDINE HCL, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.
3-(3,5-difluorophenyl)pyrrolidine;hydrochloride (CAS 2135332-31-7) is a chemical compound with the molecular formula C10H12ClF2N and a molecular weight of 219.66 g/mol. IUPAC name: 3-(3,5-difluorophenyl)pyrrolidine;hydrochloride. InChIKey: FCIVBTHIFNJNBP-UHFFFAOYSA-N.
| Molecular formula | C10H12ClF2N |
|---|---|
| Molecular weight | 219.66 g/mol |
| IUPAC name | 3-(3,5-difluorophenyl)pyrrolidine;hydrochloride |
| InChIKey | FCIVBTHIFNJNBP-UHFFFAOYSA-N |
| SMILES | C1CNCC1C2=CC(=CC(=C2)F)F.Cl |
Computed by PubChem (NCBI)