CAS 2137-92-0 is the registry number for 1-Nitro-4-thiocyanatobenzene, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g, 50g.
(4-nitrophenyl) thiocyanate (CAS 2137-92-0) is a chemical compound with the molecular formula C7H4N2O2S and a molecular weight of 180.19 g/mol. IUPAC name: (4-nitrophenyl) thiocyanate. InChIKey: JDZYWJUTZURMKO-UHFFFAOYSA-N.
| Molecular formula | C7H4N2O2S |
|---|---|
| Molecular weight | 180.19 g/mol |
| IUPAC name | (4-nitrophenyl) thiocyanate |
| InChIKey | JDZYWJUTZURMKO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1[N+](=O)[O-])SC#N |
Computed by PubChem (NCBI)