Products 2137434-45-6
CAS 2137434-45-6 is the registry number for rac-Methyl (1R,5R,6S)-6-aminobicyclo(3.2.0)heptane-3-carboxylate hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Methyl (1R,5R,6S)-6-aminobicyclo[3.2.0]heptane-3-carboxylate;hydrochloride (CAS 2137434-45-6) is a chemical compound with the molecular formula C9H16ClNO2 and a molecular weight of 205.68 g/mol. IUPAC name: methyl (1R,5R,6S)-6-aminobicyclo[3.2.0]heptane-3-carboxylate;hydrochloride. InChIKey: UFXVDKKOELRHID-MUGMMRPJSA-N.
| Molecular formula | C9H16ClNO2 |
|---|---|
| Molecular weight | 205.68 g/mol |
| IUPAC name | methyl (1R,5R,6S)-6-aminobicyclo[3.2.0]heptane-3-carboxylate;hydrochloride |
| InChIKey | UFXVDKKOELRHID-MUGMMRPJSA-N |
| SMILES | COC(=O)C1C[C@@H]2C[C@@H]([C@@H]2C1)N.Cl |
Computed by PubChem (NCBI)