Products 2137600-41-8
CAS 2137600-41-8 is the registry number for 2-(((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)methyl)-3,3,3-trifluoropropanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]-3,3,3-trifluoropropanoic acid (CAS 2137600-41-8) is a chemical compound with the molecular formula C19H16F3NO4 and a molecular weight of 379.3 g/mol. IUPAC name: 2-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]-3,3,3-trifluoropropanoic acid. InChIKey: CHQFKSRBLAHHEJ-UHFFFAOYSA-N.
| Molecular formula | C19H16F3NO4 |
|---|---|
| Molecular weight | 379.3 g/mol |
| IUPAC name | 2-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]-3,3,3-trifluoropropanoic acid |
| InChIKey | CHQFKSRBLAHHEJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCC(C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)