CAS 181128-48-3 appears in our catalog under these names: (S)-Fmoc-2-amino-4,4,4-trifluoro-butyric acid, 95%, (S)–2–((((9H–Fluoren–9–yl)methoxy)carbonyl)amino)–4,4,4–trifluorobutanoic acid, Fmoc-L-TfAbu-OH, Fmoc-Ala(CF3)-OH 98%, (S)-Fmoc-2-amino-4,4,4-trifluoro-butyric acid, 98%, 98%. Offered by: Combi-blocks, GLPBio, Iris Biotech, Ambeed, Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg, 50mg, 10g.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4,4,4-trifluorobutanoic acid (CAS 181128-48-3) is a chemical compound with the molecular formula C19H16F3NO4 and a molecular weight of 379.3 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4,4,4-trifluorobutanoic acid. InChIKey: CHNDOSLXDQUFJI-INIZCTEOSA-N.
| Molecular formula | C19H16F3NO4 |
|---|---|
| Molecular weight | 379.3 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4,4,4-trifluorobutanoic acid |
| InChIKey | CHNDOSLXDQUFJI-INIZCTEOSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CC(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)