CAS 1219145-37-5 appears in our catalog under these names: Fmoc-2-amino-4,4,4-trifluorobutyric acid, 95%, FMOC-2-Amino-4,4,4-trifluorobutyric acid, Fmoc-DL-Ala(CF3)-OH 95%. Offered by: Combi-blocks, Biosynth, Ambeed. Available pack sizes: 1g, 100mg, 250mg, 50mg, 0,5g.
2-(9H-fluoren-9-ylmethoxycarbonylamino)-4,4,4-trifluorobutanoic acid (CAS 1219145-37-5) is a chemical compound with the molecular formula C19H16F3NO4 and a molecular weight of 379.3 g/mol. IUPAC name: 2-(9H-fluoren-9-ylmethoxycarbonylamino)-4,4,4-trifluorobutanoic acid. InChIKey: CHNDOSLXDQUFJI-UHFFFAOYSA-N.
| Molecular formula | C19H16F3NO4 |
|---|---|
| Molecular weight | 379.3 g/mol |
| IUPAC name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-4,4,4-trifluorobutanoic acid |
| InChIKey | CHNDOSLXDQUFJI-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC(CC(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)