CAS 194471-86-8 appears in our catalog under these names: (R,S)-Fmoc-3-amino-4,4,4-trifluoro-butyric acid, 95%, Fmoc-3-amino-4,4,4-trifluoro-butyric acid (SR), Fmoc-3-amino-4,4,4-trifluorobutyric acid, R,S-Fmoc-3-amino-4,4,4-trifluoro-butyric acid 97%, (R,S)-Fmoc-3-amino-4,4,4-trifluoro-butyric acid, 97%, 97%. Offered by: Combi-blocks, Iris Biotech, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 100mg, 250mg, 50mg, 0,5g.
3-(9H-fluoren-9-ylmethoxycarbonylamino)-4,4,4-trifluorobutanoic acid (CAS 194471-86-8) is a chemical compound with the molecular formula C19H16F3NO4 and a molecular weight of 379.3 g/mol. IUPAC name: 3-(9H-fluoren-9-ylmethoxycarbonylamino)-4,4,4-trifluorobutanoic acid. InChIKey: WCJXAGGMJPEDDU-UHFFFAOYSA-N.
| Molecular formula | C19H16F3NO4 |
|---|---|
| Molecular weight | 379.3 g/mol |
| IUPAC name | 3-(9H-fluoren-9-ylmethoxycarbonylamino)-4,4,4-trifluorobutanoic acid |
| InChIKey | WCJXAGGMJPEDDU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC(CC(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)