CAS 2044711-52-4 appears in our catalog under these names: (R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-4,4,4-trifluorobutanoic acid, 97%, Fmoc-3-CF3-D-Ala-OH 97%, (R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-4,4,4-trifluorobutanoic acid, 98%, 98%, (R)-Fmoc-2-amino-4,4,4-trifluoro-butyric acid, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g, 10g.
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4,4,4-trifluorobutanoic acid (CAS 2044711-52-4) is a chemical compound with the molecular formula C19H16F3NO4 and a molecular weight of 379.3 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4,4,4-trifluorobutanoic acid. InChIKey: CHNDOSLXDQUFJI-MRXNPFEDSA-N.
| Molecular formula | C19H16F3NO4 |
|---|---|
| Molecular weight | 379.3 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4,4,4-trifluorobutanoic acid |
| InChIKey | CHNDOSLXDQUFJI-MRXNPFEDSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@H](CC(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)