CAS 916825-05-3 is the registry number for 1-Alpha-amino(2-hydroxyphenyl)methyl-2-naphthol trifluoroacetate, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 250mg, 1g.
1-[amino-(2-hydroxyphenyl)methyl]naphthalen-2-ol;2,2,2-trifluoroacetic acid (CAS 916825-05-3) is a chemical compound with the molecular formula C19H16F3NO4 and a molecular weight of 379.3 g/mol. IUPAC name: 1-[amino-(2-hydroxyphenyl)methyl]naphthalen-2-ol;2,2,2-trifluoroacetic acid. InChIKey: MXXWJBQRZWXDQY-UHFFFAOYSA-N.
| Molecular formula | C19H16F3NO4 |
|---|---|
| Molecular weight | 379.3 g/mol |
| IUPAC name | 1-[amino-(2-hydroxyphenyl)methyl]naphthalen-2-ol;2,2,2-trifluoroacetic acid |
| InChIKey | MXXWJBQRZWXDQY-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=C2C(C3=CC=CC=C3O)N)O.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)