CAS 1932361-33-5 is the registry number for (R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3,3,3-trifluoro-2-methylpropanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3,3,3-trifluoro-2-methylpropanoic acid (CAS 1932361-33-5) is a chemical compound with the molecular formula C19H16F3NO4 and a molecular weight of 379.3 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3,3,3-trifluoro-2-methylpropanoic acid. InChIKey: WDBDMOCINHCAEN-GOSISDBHSA-N.
| Molecular formula | C19H16F3NO4 |
|---|---|
| Molecular weight | 379.3 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3,3,3-trifluoro-2-methylpropanoic acid |
| InChIKey | WDBDMOCINHCAEN-GOSISDBHSA-N |
| SMILES | C[C@@](C(=O)O)(C(F)(F)F)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)