Products 1310680-34-2

CAS 1310680-34-2 appears in our catalog under these names: (R)-Fmoc-3-amino-4,4,4-trifluoro-butyric acid, 95%, Fmoc-3-amino-4,4,4-trifluoro-butyric acid (R). Offered by: Combi-blocks, Iris Biotech. Available pack sizes: 1g, 100mg, 250mg, 5g.

Structural formula: {0} (CAS {1})

(3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4,4,4-trifluorobutanoic acid (CAS 1310680-34-2) is a chemical compound with the molecular formula C19H16F3NO4 and a molecular weight of 379.3 g/mol. IUPAC name: (3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4,4,4-trifluorobutanoic acid. InChIKey: WCJXAGGMJPEDDU-MRXNPFEDSA-N.

Identity
Molecular formulaC19H16F3NO4
Molecular weight379.3 g/mol
IUPAC name(3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4,4,4-trifluorobutanoic acid
InChIKeyWCJXAGGMJPEDDU-MRXNPFEDSA-N
SMILESC1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@H](CC(=O)O)C(F)(F)F

Computed by PubChem (NCBI)