Products 2137895-33-9
CAS 2137895-33-9 is the registry number for {(1,2,4)Triazolo(1,5-a)pyridin-8-yl}methanamine dihydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
[1,2,4]triazolo[1,5-a]pyridin-8-ylmethanamine;dihydrochloride (CAS 2137895-33-9) is a chemical compound with the molecular formula C7H10Cl2N4 and a molecular weight of 221.08 g/mol. IUPAC name: [1,2,4]triazolo[1,5-a]pyridin-8-ylmethanamine;dihydrochloride. InChIKey: JURYUKIUHDSHEP-UHFFFAOYSA-N.
| Molecular formula | C7H10Cl2N4 |
|---|---|
| Molecular weight | 221.08 g/mol |
| IUPAC name | [1,2,4]triazolo[1,5-a]pyridin-8-ylmethanamine;dihydrochloride |
| InChIKey | JURYUKIUHDSHEP-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=NC=N2)C(=C1)CN.Cl.Cl |
Computed by PubChem (NCBI)