Products 2138172-06-0
CAS 2138172-06-0 is the registry number for rac-(1R,3R)-3-Ethoxy-7-oxaspiro(3.5)nonan-1-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(1R,3R)-3-ethoxy-7-oxaspiro[3.5]nonan-1-amine;hydrochloride (CAS 2138172-06-0) is a chemical compound with the molecular formula C10H20ClNO2 and a molecular weight of 221.72 g/mol. IUPAC name: (1R,3R)-3-ethoxy-7-oxaspiro[3.5]nonan-1-amine;hydrochloride. InChIKey: PEHTVYJVEBXOBD-VTLYIQCISA-N.
| Molecular formula | C10H20ClNO2 |
|---|---|
| Molecular weight | 221.72 g/mol |
| IUPAC name | (1R,3R)-3-ethoxy-7-oxaspiro[3.5]nonan-1-amine;hydrochloride |
| InChIKey | PEHTVYJVEBXOBD-VTLYIQCISA-N |
| SMILES | CCO[C@@H]1C[C@H](C12CCOCC2)N.Cl |
Computed by PubChem (NCBI)