CAS 2138186-74-8 is the registry number for 2-(Methoxymethoxy)-6-methylbenzene-1-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(methoxymethoxy)-6-methylbenzenesulfonyl chloride (CAS 2138186-74-8) is a chemical compound with the molecular formula C9H11ClO4S and a molecular weight of 250.70 g/mol. IUPAC name: 2-(methoxymethoxy)-6-methylbenzenesulfonyl chloride. InChIKey: DYBIXWSNZKFUAV-UHFFFAOYSA-N.
| Molecular formula | C9H11ClO4S |
|---|---|
| Molecular weight | 250.70 g/mol |
| IUPAC name | 2-(methoxymethoxy)-6-methylbenzenesulfonyl chloride |
| InChIKey | DYBIXWSNZKFUAV-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)OCOC)S(=O)(=O)Cl |
Computed by PubChem (NCBI)