CAS 2138335-79-0 is the registry number for 2,6-Difluoro-3-(hydroxymethyl)benzoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
2,6-difluoro-3-(hydroxymethyl)benzoic acid (CAS 2138335-79-0) is a chemical compound with the molecular formula C8H6F2O3 and a molecular weight of 188.13 g/mol. IUPAC name: 2,6-difluoro-3-(hydroxymethyl)benzoic acid. InChIKey: WRJHCFDSLVFPDL-UHFFFAOYSA-N.
| Molecular formula | C8H6F2O3 |
|---|---|
| Molecular weight | 188.13 g/mol |
| IUPAC name | 2,6-difluoro-3-(hydroxymethyl)benzoic acid |
| InChIKey | WRJHCFDSLVFPDL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1CO)F)C(=O)O)F |
Computed by PubChem (NCBI)