Products 2138335-79-0

CAS 2138335-79-0 is the registry number for 2,6-Difluoro-3-(hydroxymethyl)benzoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.

Structural formula: {0} (CAS {1})

2,6-difluoro-3-(hydroxymethyl)benzoic acid (CAS 2138335-79-0) is a chemical compound with the molecular formula C8H6F2O3 and a molecular weight of 188.13 g/mol. IUPAC name: 2,6-difluoro-3-(hydroxymethyl)benzoic acid. InChIKey: WRJHCFDSLVFPDL-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6F2O3
Molecular weight188.13 g/mol
IUPAC name2,6-difluoro-3-(hydroxymethyl)benzoic acid
InChIKeyWRJHCFDSLVFPDL-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1CO)F)C(=O)O)F

Computed by PubChem (NCBI)